C17H35N3O3 — CID 11012931
(3R)-3-(nonylcarbamoylamino)-4-(trimethylazaniumyl)butanoate (PubChem CID 11012931) has the molecular formula C17H35N3O3 and a molecular weight of 329.49 g/mol. Its IUPAC name is (3R)-3-(nonylcarbamoylamino)-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-(nonylcarbamoylamino)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 11012931 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (3R)-3-(nonylcarbamoylamino)-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCCNC(=O)N[C@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C17H35N3O3/c1-5-6-7-8-9-10-11-12-18-17(23)19-15(13-16(21)22)14-20(2,3)4/h15H,5-14H2,1-4H3,(H2-,18,19,21,22,23)/t15-/m1/s1 |
| InChIKey | JSALLKVJVSPQDX-OAHLLOKOSA-N |
| XLogP | 1.25 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|