C15H31N3O3 — CID 87453786
3-[amino-(trimethylazaniumyl)methyl]-4-(heptylamino)-4-oxobutanoate (PubChem CID 87453786) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-[amino-(trimethylazaniumyl)methyl]-4-(heptylamino)-4-oxobutanoate.
| Compound Name | 3-[amino-(trimethylazaniumyl)methyl]-4-(heptylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 87453786 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 3-[amino-(trimethylazaniumyl)methyl]-4-(heptylamino)-4-oxobutanoate |
| SMILES | CCCCCCCNC(=O)C(CC(=O)[O-])C(N)[N+](C)(C)C |
| InChI | InChI=1S/C15H31N3O3/c1-5-6-7-8-9-10-17-15(21)12(11-13(19)20)14(16)18(2,3)4/h12,14H,5-11,16H2,1-4H3,(H-,17,19,20,21) |
| InChIKey | PXHXJVUQUVXJGU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|