C17H36N3O3+ — CID 10980404
[(2S)-3-carboxy-2-(nonylcarbamoylamino)propyl]-trimethylazanium (PubChem CID 10980404) has the molecular formula C17H36N3O3+ and a molecular weight of 330.49 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-(nonylcarbamoylamino)propyl]-trimethylazanium.
| Compound Name | [(2S)-3-carboxy-2-(nonylcarbamoylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 10980404 |
| Molecular Formula | C17H36N3O3+ |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | [(2S)-3-carboxy-2-(nonylcarbamoylamino)propyl]-trimethylazanium |
| SMILES | CCCCCCCCCNC(=O)N[C@@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C17H35N3O3/c1-5-6-7-8-9-10-11-12-18-17(23)19-15(13-16(21)22)14-20(2,3)4/h15H,5-14H2,1-4H3,(H2-,18,19,21,22,23)/p+1/t15-/m0/s1 |
| InChIKey | JSALLKVJVSPQDX-HNNXBMFYSA-O |
| XLogP | 2.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|