C15H32N3O3+ — CID 10924625
[(2R)-3-carboxy-2-(heptylcarbamoylamino)propyl]-trimethylazanium (PubChem CID 10924625) has the molecular formula C15H32N3O3+ and a molecular weight of 302.44 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-(heptylcarbamoylamino)propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-(heptylcarbamoylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 10924625 |
| Molecular Formula | C15H32N3O3+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | [(2R)-3-carboxy-2-(heptylcarbamoylamino)propyl]-trimethylazanium |
| SMILES | CCCCCCCNC(=O)N[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C15H31N3O3/c1-5-6-7-8-9-10-16-15(21)17-13(11-14(19)20)12-18(2,3)4/h13H,5-12H2,1-4H3,(H2-,16,17,19,20,21)/p+1/t13-/m1/s1 |
| InChIKey | GMDMVIVFFXESDQ-CYBMUJFWSA-O |
| XLogP | 1.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|