C16H33N2O4+ — CID 11034440
[(2S)-3-carboxy-2-(octoxycarbonylamino)propyl]-trimethylazanium (PubChem CID 11034440) has the molecular formula C16H33N2O4+ and a molecular weight of 317.45 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-(octoxycarbonylamino)propyl]-trimethylazanium.
| Compound Name | [(2S)-3-carboxy-2-(octoxycarbonylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 11034440 |
| Molecular Formula | C16H33N2O4+ |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | [(2S)-3-carboxy-2-(octoxycarbonylamino)propyl]-trimethylazanium |
| SMILES | CCCCCCCCOC(=O)N[C@@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C16H32N2O4/c1-5-6-7-8-9-10-11-22-16(21)17-14(12-15(19)20)13-18(2,3)4/h14H,5-13H2,1-4H3,(H-,17,19,20,21)/p+1/t14-/m0/s1 |
| InChIKey | ZTANFHVWOWCBLM-AWEZNQCLSA-O |
| XLogP | 2.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|