C22H38N3O6S+ — CID 69173184
[3-carboxy-2-[[4-(octoxycarbonylamino)phenyl]sulfonylamino]propyl]-trimethylazanium (PubChem CID 69173184) has the molecular formula C22H38N3O6S+ and a molecular weight of 472.63 g/mol. Its IUPAC name is [3-carboxy-2-[[4-(octoxycarbonylamino)phenyl]sulfonylamino]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[[4-(octoxycarbonylamino)phenyl]sulfonylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 69173184 |
| Molecular Formula | C22H38N3O6S+ |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [3-carboxy-2-[[4-(octoxycarbonylamino)phenyl]sulfonylamino]propyl]-trimethylazanium |
| SMILES | CCCCCCCCOC(=O)Nc1ccc(S(=O)(=O)NC(CC(=O)O)C[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C22H37N3O6S/c1-5-6-7-8-9-10-15-31-22(28)23-18-11-13-20(14-12-18)32(29,30)24-19(16-21(26)27)17-25(2,3)4/h11-14,19,24H,5-10,15-17H2,1-4H3,(H-,23,26,27,28)/p+1 |
| InChIKey | ZHQYKUUAJLPELI-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|