C20H25ClN2O4S — CID 2250939
heptyl N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]carbamate (PubChem CID 2250939) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is heptyl N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]carbamate.
| Compound Name | heptyl N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 2250939 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | heptyl N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]carbamate |
| SMILES | CCCCCCCOC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O4S/c1-2-3-4-5-8-15-27-20(24)22-16-11-13-17(14-12-16)28(25,26)23-19-10-7-6-9-18(19)21/h6-7,9-14,23H,2-5,8,15H2,1H3,(H,22,24) |
| InChIKey | KNKHYTZMJCDIMI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|