C18H19Cl2N2NaO4S — CID 140902040
sodium (2,6-dichlorophenyl)-[4-(pentoxycarbonylamino)phenyl]sulfonylazanide (PubChem CID 140902040) has the molecular formula C18H19Cl2N2NaO4S and a molecular weight of 453.32 g/mol. Its IUPAC name is sodium (2,6-dichlorophenyl)-[4-(pentoxycarbonylamino)phenyl]sulfonylazanide.
| Compound Name | sodium (2,6-dichlorophenyl)-[4-(pentoxycarbonylamino)phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 140902040 |
| Molecular Formula | C18H19Cl2N2NaO4S |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | sodium (2,6-dichlorophenyl)-[4-(pentoxycarbonylamino)phenyl]sulfonylazanide |
| SMILES | CCCCCOC(=O)Nc1ccc(S(=O)(=O)[N-]c2c(Cl)cccc2Cl)cc1.[Na+] |
| InChI | InChI=1S/C18H19Cl2N2O4S.Na/c1-2-3-4-12-26-18(23)21-13-8-10-14(11-9-13)27(24,25)22-17-15(19)6-5-7-16(17)20;/h5-11H,2-4,12H2,1H3,(H,21,23);/q-1;+1 |
| InChIKey | FLKATMPQSJPQRZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|