C17H19IN2O4S — CID 2248835
butyl N-[4-[(2-iodophenyl)sulfamoyl]phenyl]carbamate (PubChem CID 2248835) has the molecular formula C17H19IN2O4S and a molecular weight of 474.32 g/mol. Its IUPAC name is butyl N-[4-[(2-iodophenyl)sulfamoyl]phenyl]carbamate.
| Compound Name | butyl N-[4-[(2-iodophenyl)sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 2248835 |
| Molecular Formula | C17H19IN2O4S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | butyl N-[4-[(2-iodophenyl)sulfamoyl]phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2I)cc1 |
| InChI | InChI=1S/C17H19IN2O4S/c1-2-3-12-24-17(21)19-13-8-10-14(11-9-13)25(22,23)20-16-7-5-4-6-15(16)18/h4-11,20H,2-3,12H2,1H3,(H,19,21) |
| InChIKey | YLIJBQSWPLULCB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|