C23H30N2O4 — CID 141353878
butyl N-[2-[[4-(butoxycarbonylamino)phenyl]methyl]phenyl]carbamate (PubChem CID 141353878) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is butyl N-[2-[[4-(butoxycarbonylamino)phenyl]methyl]phenyl]carbamate.
| Compound Name | butyl N-[2-[[4-(butoxycarbonylamino)phenyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 141353878 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | butyl N-[2-[[4-(butoxycarbonylamino)phenyl]methyl]phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(Cc2ccccc2NC(=O)OCCCC)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-3-5-15-28-22(26)24-20-13-11-18(12-14-20)17-19-9-7-8-10-21(19)25-23(27)29-16-6-4-2/h7-14H,3-6,15-17H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | VVRBFPPYIQPKMM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|