C18H24N4O2 — CID 174727415
butyl N-[4-[2-amino-3-(aminomethyl)anilino]phenyl]carbamate (PubChem CID 174727415) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is butyl N-[4-[2-amino-3-(aminomethyl)anilino]phenyl]carbamate.
| Compound Name | butyl N-[4-[2-amino-3-(aminomethyl)anilino]phenyl]carbamate |
|---|---|
| PubChem CID | 174727415 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | butyl N-[4-[2-amino-3-(aminomethyl)anilino]phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(Nc2cccc(CN)c2N)cc1 |
| InChI | InChI=1S/C18H24N4O2/c1-2-3-11-24-18(23)22-15-9-7-14(8-10-15)21-16-6-4-5-13(12-19)17(16)20/h4-10,21H,2-3,11-12,19-20H2,1H3,(H,22,23) |
| InChIKey | QFXXBPMNZSOJOS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|