C26H35IN2O4 — CID 163725060
5-iodopentyl N-[4-[[4-(hexoxycarbonylamino)phenyl]methyl]phenyl]carbamate (PubChem CID 163725060) has the molecular formula C26H35IN2O4 and a molecular weight of 566.48 g/mol. Its IUPAC name is 5-iodopentyl N-[4-[[4-(hexoxycarbonylamino)phenyl]methyl]phenyl]carbamate.
| Compound Name | 5-iodopentyl N-[4-[[4-(hexoxycarbonylamino)phenyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 163725060 |
| Molecular Formula | C26H35IN2O4 |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 5-iodopentyl N-[4-[[4-(hexoxycarbonylamino)phenyl]methyl]phenyl]carbamate |
| SMILES | CCCCCCOC(=O)Nc1ccc(Cc2ccc(NC(=O)OCCCCCI)cc2)cc1 |
| InChI | InChI=1S/C26H35IN2O4/c1-2-3-4-7-18-32-25(30)28-23-13-9-21(10-14-23)20-22-11-15-24(16-12-22)29-26(31)33-19-8-5-6-17-27/h9-16H,2-8,17-20H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | KUVZZQNFHUQJET-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|