C45H56N4O8 — CID 134368618
methyl N-[4-[[4-[[6-ethyl-11-[[4-[[4-(methoxycarbonylamino)phenyl]methyl]phenyl]carbamoyloxy]undecoxy]carbonylamino]phenyl]methyl]phenyl]carbamate (PubChem CID 134368618) has the molecular formula C45H56N4O8 and a molecular weight of 780.96 g/mol. Its IUPAC name is methyl N-[4-[[4-[[6-ethyl-11-[[4-[[4-(methoxycarbonylamino)phenyl]methyl]phenyl]carbamoyloxy]undecoxy]carbonylamino]phenyl]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[4-[[6-ethyl-11-[[4-[[4-(methoxycarbonylamino)phenyl]methyl]phenyl]carbamoyloxy]undecoxy]carbonylamino]phenyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 134368618 |
| Molecular Formula | C45H56N4O8 |
| Molecular Weight | 780.96 g/mol |
| Exact Mass | 780.41 |
| IUPAC Name | methyl N-[4-[[4-[[6-ethyl-11-[[4-[[4-(methoxycarbonylamino)phenyl]methyl]phenyl]carbamoyloxy]undecoxy]carbonylamino]phenyl]methyl]phenyl]carbamate |
| SMILES | CCC(CCCCCOC(=O)Nc1ccc(Cc2ccc(NC(=O)OC)cc2)cc1)CCCCCOC(=O)Nc1ccc(Cc2ccc(NC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C45H56N4O8/c1-4-33(11-7-5-9-29-56-44(52)48-40-25-17-36(18-26-40)31-34-13-21-38(22-14-34)46-42(50)54-2)12-8-6-10-30-57-45(53)49-41-27-19-37(20-28-41)32-35-15-23-39(24-16-35)47-43(51)55-3/h13-28,33H,4-12,29-32H2,1-3H3,(H,46,50)(H,47,51)(H,48,52)(H,49,53) |
| InChIKey | CZKHRTQKRITZIO-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.96 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|