C24H30N2O7 — CID 176863887
3-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoyloxy]propyl 3-methoxypropyl carbonate (PubChem CID 176863887) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoyloxy]propyl 3-methoxypropyl carbonate.
| Compound Name | 3-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoyloxy]propyl 3-methoxypropyl carbonate |
|---|---|
| PubChem CID | 176863887 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 3-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoyloxy]propyl 3-methoxypropyl carbonate |
| SMILES | COCCCOC(=O)OCCCOC(=O)Nc1ccc(Cc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O7/c1-18(27)25-21-9-5-19(6-10-21)17-20-7-11-22(12-8-20)26-23(28)31-14-4-16-33-24(29)32-15-3-13-30-2/h5-12H,3-4,13-17H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | DTCSBQKSAFVOQI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|