C26H36N2O5 — CID 130347168
2-methoxyethyl N-[4-[[4-(2,5-dimethylhexan-3-yloxycarbonylamino)phenyl]methyl]phenyl]carbamate (PubChem CID 130347168) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-[[4-(2,5-dimethylhexan-3-yloxycarbonylamino)phenyl]methyl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-[[4-(2,5-dimethylhexan-3-yloxycarbonylamino)phenyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 130347168 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-methoxyethyl N-[4-[[4-(2,5-dimethylhexan-3-yloxycarbonylamino)phenyl]methyl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1ccc(Cc2ccc(NC(=O)OC(CC(C)C)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O5/c1-18(2)16-24(19(3)4)33-26(30)28-23-12-8-21(9-13-23)17-20-6-10-22(11-7-20)27-25(29)32-15-14-31-5/h6-13,18-19,24H,14-17H2,1-5H3,(H,27,29)(H,28,30) |
| InChIKey | QFYPBGOKCNLOJA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|