C23H33NO3Si — CID 69145954
2-trimethylsilylethyl N-[4-[[4-(propan-2-yloxymethyl)phenyl]methyl]phenyl]carbamate (PubChem CID 69145954) has the molecular formula C23H33NO3Si and a molecular weight of 399.61 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[4-[[4-(propan-2-yloxymethyl)phenyl]methyl]phenyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[4-[[4-(propan-2-yloxymethyl)phenyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69145954 |
| Molecular Formula | C23H33NO3Si |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-trimethylsilylethyl N-[4-[[4-(propan-2-yloxymethyl)phenyl]methyl]phenyl]carbamate |
| SMILES | CC(C)OCc1ccc(Cc2ccc(NC(=O)OCC[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H33NO3Si/c1-18(2)27-17-21-8-6-19(7-9-21)16-20-10-12-22(13-11-20)24-23(25)26-14-15-28(3,4)5/h6-13,18H,14-17H2,1-5H3,(H,24,25) |
| InChIKey | TYDLXNUCTBUGLP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|