C16H30N2O4 — CID 144997523
[4-(2-aminoethoxycarbonylamino)phenyl]methyl 2-methylpropanoate;ethane;molecular hydrogen (PubChem CID 144997523) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is [4-(2-aminoethoxycarbonylamino)phenyl]methyl 2-methylpropanoate;ethane;molecular hydrogen.
| Compound Name | [4-(2-aminoethoxycarbonylamino)phenyl]methyl 2-methylpropanoate;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144997523 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | [4-(2-aminoethoxycarbonylamino)phenyl]methyl 2-methylpropanoate;ethane;molecular hydrogen |
| SMILES | CC.CC(C)C(=O)OCc1ccc(NC(=O)OCCN)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C14H20N2O4.C2H6.2H2/c1-10(2)13(17)20-9-11-3-5-12(6-4-11)16-14(18)19-8-7-15;1-2;;/h3-6,10H,7-9,15H2,1-2H3,(H,16,18);1-2H3;2*1H |
| InChIKey | IIEZWYCZEDWZGS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |