C15H20INO3 — CID 142531432
[4-(2-methylpropanoylamino)phenyl]methyl (2S)-3-iodo-2-methylpropanoate (PubChem CID 142531432) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is [4-(2-methylpropanoylamino)phenyl]methyl (2S)-3-iodo-2-methylpropanoate.
| Compound Name | [4-(2-methylpropanoylamino)phenyl]methyl (2S)-3-iodo-2-methylpropanoate |
|---|---|
| PubChem CID | 142531432 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [4-(2-methylpropanoylamino)phenyl]methyl (2S)-3-iodo-2-methylpropanoate |
| SMILES | CC(C)C(=O)Nc1ccc(COC(=O)[C@H](C)CI)cc1 |
| InChI | InChI=1S/C15H20INO3/c1-10(2)14(18)17-13-6-4-12(5-7-13)9-20-15(19)11(3)8-16/h4-7,10-11H,8-9H2,1-3H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | PGFVFLAZRRZATB-LLVKDONJSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|