C12H16N2O3 — CID 58122561
[4-(2-methylpropanoylamino)phenyl]methyl N-deuteriocarbamate (PubChem CID 58122561) has the molecular formula C12H16N2O3 and a molecular weight of 237.28 g/mol. Its IUPAC name is [4-(2-methylpropanoylamino)phenyl]methyl N-deuteriocarbamate.
| Compound Name | [4-(2-methylpropanoylamino)phenyl]methyl N-deuteriocarbamate |
|---|---|
| PubChem CID | 58122561 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [4-(2-methylpropanoylamino)phenyl]methyl N-deuteriocarbamate |
| SMILES | [2H]NC(=O)OCc1ccc(NC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C12H16N2O3/c1-8(2)11(15)14-10-5-3-9(4-6-10)7-17-12(13)16/h3-6,8H,7H2,1-2H3,(H2,13,16)(H,14,15)/i/hD |
| InChIKey | CAVJMAMKCUIORZ-DYCDLGHISA-N |
| XLogP | 1.88 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |