C19H26N2O3 — CID 144683165
methyl N-[4-[[4-(2-methylpropanoylamino)phenyl]methyl]phenyl]carbamate;molecular hydrogen (PubChem CID 144683165) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl N-[4-[[4-(2-methylpropanoylamino)phenyl]methyl]phenyl]carbamate;molecular hydrogen.
| Compound Name | methyl N-[4-[[4-(2-methylpropanoylamino)phenyl]methyl]phenyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 144683165 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methyl N-[4-[[4-(2-methylpropanoylamino)phenyl]methyl]phenyl]carbamate;molecular hydrogen |
| SMILES | COC(=O)Nc1ccc(Cc2ccc(NC(=O)C(C)C)cc2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C19H22N2O3.2H2/c1-13(2)18(22)20-16-8-4-14(5-9-16)12-15-6-10-17(11-7-15)21-19(23)24-3;;/h4-11,13H,12H2,1-3H3,(H,20,22)(H,21,23);2*1H |
| InChIKey | FVGXXVOBOUNWIR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |