C11H13ClN2O3 — CID 43701229
methyl N-[4-(2-chloropropanoylamino)phenyl]carbamate (PubChem CID 43701229) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is methyl N-[4-(2-chloropropanoylamino)phenyl]carbamate.
| Compound Name | methyl N-[4-(2-chloropropanoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 43701229 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | methyl N-[4-(2-chloropropanoylamino)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)C(C)Cl)cc1 |
| InChI | InChI=1S/C11H13ClN2O3/c1-7(12)10(15)13-8-3-5-9(6-4-8)14-11(16)17-2/h3-7H,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | HQTXBFSDCSERGJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|