C12H18FNO2Si — CID 68758194
2-trimethylsilylethyl N-(3-fluorophenyl)carbamate (PubChem CID 68758194) has the molecular formula C12H18FNO2Si and a molecular weight of 255.37 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-(3-fluorophenyl)carbamate.
| Compound Name | 2-trimethylsilylethyl N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 68758194 |
| Molecular Formula | C12H18FNO2Si |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-trimethylsilylethyl N-(3-fluorophenyl)carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H18FNO2Si/c1-17(2,3)8-7-16-12(15)14-11-6-4-5-10(13)9-11/h4-6,9H,7-8H2,1-3H3,(H,14,15) |
| InChIKey | SLNQAUXSQIJTER-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|