C18H20FN3O4 — CID 47077792
2-methoxyethyl N-[3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]phenyl]carbamate (PubChem CID 47077792) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 47077792 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-methoxyethyl N-[3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(NCC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H20FN3O4/c1-25-8-9-26-18(24)22-16-7-3-5-14(11-16)20-12-17(23)21-15-6-2-4-13(19)10-15/h2-7,10-11,20H,8-9,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | XAEJKVQKOOYMIS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|