C16H17FN2O — CID 9098883
N-(3,4-dimethylphenyl)-2-(3-fluoroanilino)acetamide (PubChem CID 9098883) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-(3-fluoroanilino)acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-(3-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 9098883 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-(3-fluoroanilino)acetamide |
| SMILES | Cc1ccc(NC(=O)CNc2cccc(F)c2)cc1C |
| InChI | InChI=1S/C16H17FN2O/c1-11-6-7-15(8-12(11)2)19-16(20)10-18-14-5-3-4-13(17)9-14/h3-9,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | OCPZVIBHTSQUNH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |