C11H15NO3S — CID 146357329
2-methoxyethyl N-(3-methylsulfanylphenyl)carbamate (PubChem CID 146357329) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-methoxyethyl N-(3-methylsulfanylphenyl)carbamate.
| Compound Name | 2-methoxyethyl N-(3-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 146357329 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-methoxyethyl N-(3-methylsulfanylphenyl)carbamate |
| SMILES | COCCOC(=O)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-14-6-7-15-11(13)12-9-4-3-5-10(8-9)16-2/h3-5,8H,6-7H2,1-2H3,(H,12,13) |
| InChIKey | BFGNWFAAGQFHST-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|