C15H23N3O5 — CID 95583256
2-methoxyethyl N-[3-[[(2R)-1-hydroxybutan-2-yl]carbamoylamino]phenyl]carbamate (PubChem CID 95583256) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[[(2R)-1-hydroxybutan-2-yl]carbamoylamino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[[(2R)-1-hydroxybutan-2-yl]carbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 95583256 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-methoxyethyl N-[3-[[(2R)-1-hydroxybutan-2-yl]carbamoylamino]phenyl]carbamate |
| SMILES | CC[C@H](CO)NC(=O)Nc1cccc(NC(=O)OCCOC)c1 |
| InChI | InChI=1S/C15H23N3O5/c1-3-11(10-19)16-14(20)17-12-5-4-6-13(9-12)18-15(21)23-8-7-22-2/h4-6,9,11,19H,3,7-8,10H2,1-2H3,(H,18,21)(H2,16,17,20)/t11-/m1/s1 |
| InChIKey | RQLNNSUYTZGLLN-LLVKDONJSA-N |
| XLogP | 1.77 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|