C23H35NO9S — CID 91277018
5-[2-[2-[2-[2-[2-[(3-methylsulfanylphenyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pent-2-enoic acid (PubChem CID 91277018) has the molecular formula C23H35NO9S and a molecular weight of 501.60 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-[2-[(3-methylsulfanylphenyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pent-2-enoic acid.
| Compound Name | 5-[2-[2-[2-[2-[2-[(3-methylsulfanylphenyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 91277018 |
| Molecular Formula | C23H35NO9S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 5-[2-[2-[2-[2-[2-[(3-methylsulfanylphenyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pent-2-enoic acid |
| SMILES | CSc1cccc(NC(=O)OCCOCCOCCOCCOCCOCCC=CC(=O)O)c1 |
| InChI | InChI=1S/C23H35NO9S/c1-34-21-6-4-5-20(19-21)24-23(27)33-18-17-32-16-15-31-14-13-30-12-11-29-10-9-28-8-3-2-7-22(25)26/h2,4-7,19H,3,8-18H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | ZDSGNYBFKZAKPU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|