C19H20F2N2O4 — CID 47741134
2-methoxyethyl N-[3-[3-(2,6-difluorophenyl)propanoylamino]phenyl]carbamate (PubChem CID 47741134) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[3-(2,6-difluorophenyl)propanoylamino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[3-(2,6-difluorophenyl)propanoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 47741134 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-methoxyethyl N-[3-[3-(2,6-difluorophenyl)propanoylamino]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(NC(=O)CCc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C19H20F2N2O4/c1-26-10-11-27-19(25)23-14-5-2-4-13(12-14)22-18(24)9-8-15-16(20)6-3-7-17(15)21/h2-7,12H,8-11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | LAPNQRZFWTUAGW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|