C17H21N5O4 — CID 47916523
2-methoxyethyl N-[3-[3-(pyrimidin-2-ylamino)propanoylamino]phenyl]carbamate (PubChem CID 47916523) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[3-(pyrimidin-2-ylamino)propanoylamino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[3-(pyrimidin-2-ylamino)propanoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 47916523 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-methoxyethyl N-[3-[3-(pyrimidin-2-ylamino)propanoylamino]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(NC(=O)CCNc2ncccn2)c1 |
| InChI | InChI=1S/C17H21N5O4/c1-25-10-11-26-17(24)22-14-5-2-4-13(12-14)21-15(23)6-9-20-16-18-7-3-8-19-16/h2-5,7-8,12H,6,9-11H2,1H3,(H,21,23)(H,22,24)(H,18,19,20) |
| InChIKey | RZXQDEGUQLGMLV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|