C15H19N5O — CID 71708363
N-pyridin-4-yl-6-(pyrimidin-2-ylamino)hexanamide (PubChem CID 71708363) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-pyridin-4-yl-6-(pyrimidin-2-ylamino)hexanamide.
| Compound Name | N-pyridin-4-yl-6-(pyrimidin-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 71708363 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-pyridin-4-yl-6-(pyrimidin-2-ylamino)hexanamide |
| SMILES | O=C(CCCCCNc1ncccn1)Nc1ccncc1 |
| InChI | InChI=1S/C15H19N5O/c21-14(20-13-6-11-16-12-7-13)5-2-1-3-8-17-15-18-9-4-10-19-15/h4,6-7,9-12H,1-3,5,8H2,(H,16,20,21)(H,17,18,19) |
| InChIKey | ZWRXGNVEGLESQR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|