C16H21N5OS — CID 71708468
N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-6-(pyrimidin-2-ylamino)hexanamide (PubChem CID 71708468) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-6-(pyrimidin-2-ylamino)hexanamide.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-6-(pyrimidin-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 71708468 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-6-(pyrimidin-2-ylamino)hexanamide |
| SMILES | O=C(CCCCCNc1ncccn1)Nc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C16H21N5OS/c22-14(21-16-20-12-6-4-7-13(12)23-16)8-2-1-3-9-17-15-18-10-5-11-19-15/h5,10-11H,1-4,6-9H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | YXQDLOVOXRIJIS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|