C18H21N5O — CID 71707606
N-(1H-indol-5-yl)-6-(pyrimidin-2-ylamino)hexanamide (PubChem CID 71707606) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-6-(pyrimidin-2-ylamino)hexanamide.
| Compound Name | N-(1H-indol-5-yl)-6-(pyrimidin-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 71707606 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-(1H-indol-5-yl)-6-(pyrimidin-2-ylamino)hexanamide |
| SMILES | O=C(CCCCCNc1ncccn1)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H21N5O/c24-17(23-15-6-7-16-14(13-15)8-12-19-16)5-2-1-3-9-20-18-21-10-4-11-22-18/h4,6-8,10-13,19H,1-3,5,9H2,(H,23,24)(H,20,21,22) |
| InChIKey | IMNYIOMCZALZAB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|