C11H18ClN3O — CID 44666570
[6-oxo-6-(pyridin-4-ylamino)hexyl]azanium chloride (PubChem CID 44666570) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is [6-oxo-6-(pyridin-4-ylamino)hexyl]azanium chloride.
| Compound Name | [6-oxo-6-(pyridin-4-ylamino)hexyl]azanium chloride |
|---|---|
| PubChem CID | 44666570 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | [6-oxo-6-(pyridin-4-ylamino)hexyl]azanium chloride |
| SMILES | [Cl-].[NH3+]CCCCCC(=O)Nc1ccncc1 |
| InChI | InChI=1S/C11H17N3O.ClH/c12-7-3-1-2-4-11(15)14-10-5-8-13-9-6-10;/h5-6,8-9H,1-4,7,12H2,(H,13,14,15);1H |
| InChIKey | SRFKMPNQDCPOFU-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 69.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|