C12H11N3O — CID 110468100
N,2-dipyridin-4-ylacetamide (PubChem CID 110468100) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is N,2-dipyridin-4-ylacetamide.
| Compound Name | N,2-dipyridin-4-ylacetamide |
|---|---|
| PubChem CID | 110468100 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N,2-dipyridin-4-ylacetamide |
| SMILES | O=C(Cc1ccncc1)Nc1ccncc1 |
| InChI | InChI=1S/C12H11N3O/c16-12(9-10-1-5-13-6-2-10)15-11-3-7-14-8-4-11/h1-8H,9H2,(H,14,15,16) |
| InChIKey | SUBOTSVZUIFIFY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |