C16H18N2O4 — CID 27700068
N-pyridin-4-yl-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 27700068) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-pyridin-4-yl-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-pyridin-4-yl-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 27700068 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-pyridin-4-yl-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H18N2O4/c1-20-13-8-11(9-14(21-2)16(13)22-3)10-15(19)18-12-4-6-17-7-5-12/h4-9H,10H2,1-3H3,(H,17,18,19) |
| InChIKey | YKBALZIGAVXYCA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |