C19H21NO5 — CID 2406485
N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 2406485) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2406485 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2cccc(C(C)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21NO5/c1-12(21)14-6-5-7-15(11-14)20-18(22)10-13-8-16(23-2)19(25-4)17(9-13)24-3/h5-9,11H,10H2,1-4H3,(H,20,22) |
| InChIKey | VSDSJNPJGCHCLB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |