C18H19F2NO5 — CID 55742320
N-[3-(difluoromethoxy)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 55742320) has the molecular formula C18H19F2NO5 and a molecular weight of 367.35 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55742320 |
| Molecular Formula | C18H19F2NO5 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2cccc(OC(F)F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19F2NO5/c1-23-14-7-11(8-15(24-2)17(14)25-3)9-16(22)21-12-5-4-6-13(10-12)26-18(19)20/h4-8,10,18H,9H2,1-3H3,(H,21,22) |
| InChIKey | QPQIIPZQTZYIJN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |