C14H13N3OS — CID 63589271
2-(4-carbamothioylphenyl)-N-pyridin-4-ylacetamide (PubChem CID 63589271) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-(4-carbamothioylphenyl)-N-pyridin-4-ylacetamide.
| Compound Name | 2-(4-carbamothioylphenyl)-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 63589271 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-(4-carbamothioylphenyl)-N-pyridin-4-ylacetamide |
| SMILES | NC(=S)c1ccc(CC(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C14H13N3OS/c15-14(19)11-3-1-10(2-4-11)9-13(18)17-12-5-7-16-8-6-12/h1-8H,9H2,(H2,15,19)(H,16,17,18) |
| InChIKey | IUFUMWKHRGGXME-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|