C12H16N4O2S — CID 83120379
2-(4-carbamothioylphenyl)-N-[2-(carbamoylamino)ethyl]acetamide (PubChem CID 83120379) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(4-carbamothioylphenyl)-N-[2-(carbamoylamino)ethyl]acetamide.
| Compound Name | 2-(4-carbamothioylphenyl)-N-[2-(carbamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 83120379 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(4-carbamothioylphenyl)-N-[2-(carbamoylamino)ethyl]acetamide |
| SMILES | NC(=O)NCCNC(=O)Cc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C12H16N4O2S/c13-11(19)9-3-1-8(2-4-9)7-10(17)15-5-6-16-12(14)18/h1-4H,5-7H2,(H2,13,19)(H,15,17)(H3,14,16,18) |
| InChIKey | YANNZKPFJURZHG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|