C17H18N2OS — CID 62309630
N-[(4-carbamothioylphenyl)methyl]-2-(4-methylphenyl)acetamide (PubChem CID 62309630) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[(4-carbamothioylphenyl)methyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[(4-carbamothioylphenyl)methyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 62309630 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[(4-carbamothioylphenyl)methyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)NCc2ccc(C(N)=S)cc2)cc1 |
| InChI | InChI=1S/C17H18N2OS/c1-12-2-4-13(5-3-12)10-16(20)19-11-14-6-8-15(9-7-14)17(18)21/h2-9H,10-11H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | GVKGBAXVZVGXRK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|