C15H13ClN2OS — CID 63589612
2-(4-carbamothioylphenyl)-N-(3-chlorophenyl)acetamide (PubChem CID 63589612) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-(4-carbamothioylphenyl)-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-(4-carbamothioylphenyl)-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 63589612 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-(4-carbamothioylphenyl)-N-(3-chlorophenyl)acetamide |
| SMILES | NC(=S)c1ccc(CC(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H13ClN2OS/c16-12-2-1-3-13(9-12)18-14(19)8-10-4-6-11(7-5-10)15(17)20/h1-7,9H,8H2,(H2,17,20)(H,18,19) |
| InChIKey | WDAZOOFTMQQPSW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|