C19H23ClN4O2 — CID 166835235
6-[(4-chlorophenyl)methylcarbamoylamino]-N-pyridin-4-ylhexanamide (PubChem CID 166835235) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methylcarbamoylamino]-N-pyridin-4-ylhexanamide.
| Compound Name | 6-[(4-chlorophenyl)methylcarbamoylamino]-N-pyridin-4-ylhexanamide |
|---|---|
| PubChem CID | 166835235 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 6-[(4-chlorophenyl)methylcarbamoylamino]-N-pyridin-4-ylhexanamide |
| SMILES | O=C(CCCCCNC(=O)NCc1ccc(Cl)cc1)Nc1ccncc1 |
| InChI | InChI=1S/C19H23ClN4O2/c20-16-7-5-15(6-8-16)14-23-19(26)22-11-3-1-2-4-18(25)24-17-9-12-21-13-10-17/h5-10,12-13H,1-4,11,14H2,(H,21,24,25)(H2,22,23,26) |
| InChIKey | KNCKAQDEFUBDRB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|