C14H16N4O3S — CID 53498818
1-pyridin-4-yl-3-[[4-(sulfamoylmethyl)phenyl]methyl]urea (PubChem CID 53498818) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-pyridin-4-yl-3-[[4-(sulfamoylmethyl)phenyl]methyl]urea.
| Compound Name | 1-pyridin-4-yl-3-[[4-(sulfamoylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 53498818 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-pyridin-4-yl-3-[[4-(sulfamoylmethyl)phenyl]methyl]urea |
| SMILES | NS(=O)(=O)Cc1ccc(CNC(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C14H16N4O3S/c15-22(20,21)10-12-3-1-11(2-4-12)9-17-14(19)18-13-5-7-16-8-6-13/h1-8H,9-10H2,(H2,15,20,21)(H2,16,17,18,19) |
| InChIKey | FCKCBSWMZQGAQA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |