C8H12N4O — CID 82503728
1-(2-aminoethyl)-3-pyridin-4-ylurea (PubChem CID 82503728) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-pyridin-4-ylurea.
| Compound Name | 1-(2-aminoethyl)-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 82503728 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-(2-aminoethyl)-3-pyridin-4-ylurea |
| SMILES | NCCNC(=O)Nc1ccncc1 |
| InChI | InChI=1S/C8H12N4O/c9-3-6-11-8(13)12-7-1-4-10-5-2-7/h1-2,4-5H,3,6,9H2,(H2,10,11,12,13) |
| InChIKey | YYJCYFKIXDRRFK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |