C8H11FN4O — CID 69252499
1-(2-aminoethyl)-3-(6-fluoro-3-pyridinyl)urea (PubChem CID 69252499) has the molecular formula C8H11FN4O and a molecular weight of 198.20 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(6-fluoro-3-pyridinyl)urea.
| Compound Name | 1-(2-aminoethyl)-3-(6-fluoro-3-pyridinyl)urea |
|---|---|
| PubChem CID | 69252499 |
| Molecular Formula | C8H11FN4O |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(2-aminoethyl)-3-(6-fluoro-3-pyridinyl)urea |
| SMILES | NCCNC(=O)Nc1ccc(F)nc1 |
| InChI | InChI=1S/C8H11FN4O/c9-7-2-1-6(5-12-7)13-8(14)11-4-3-10/h1-2,5H,3-4,10H2,(H2,11,13,14) |
| InChIKey | HPGIFCYVWGOIMF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|