C11H15N3O2 — CID 111112659
1-[(1-hydroxycyclobutyl)methyl]-3-pyridin-4-ylurea (PubChem CID 111112659) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-[(1-hydroxycyclobutyl)methyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[(1-hydroxycyclobutyl)methyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 111112659 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-[(1-hydroxycyclobutyl)methyl]-3-pyridin-4-ylurea |
| SMILES | O=C(NCC1(O)CCC1)Nc1ccncc1 |
| InChI | InChI=1S/C11H15N3O2/c15-10(13-8-11(16)4-1-5-11)14-9-2-6-12-7-3-9/h2-3,6-7,16H,1,4-5,8H2,(H2,12,13,14,15) |
| InChIKey | SNBJPBILEOINKG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |