C13H13N3OS — CID 135231096
1-(pyridin-4-ylmethyl)-3-(4-sulfanylphenyl)urea (PubChem CID 135231096) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-(4-sulfanylphenyl)urea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-(4-sulfanylphenyl)urea |
|---|---|
| PubChem CID | 135231096 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-(4-sulfanylphenyl)urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(S)cc1 |
| InChI | InChI=1S/C13H13N3OS/c17-13(15-9-10-5-7-14-8-6-10)16-11-1-3-12(18)4-2-11/h1-8,18H,9H2,(H2,15,16,17) |
| InChIKey | SJYIJKOVPULBNK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|