C14H12FN3O3 — CID 61196451
2-fluoro-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid (PubChem CID 61196451) has the molecular formula C14H12FN3O3 and a molecular weight of 289.27 g/mol. Its IUPAC name is 2-fluoro-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 2-fluoro-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61196451 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-fluoro-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H12FN3O3/c15-12-2-1-10(7-11(12)13(19)20)18-14(21)17-8-9-3-5-16-6-4-9/h1-7H,8H2,(H,19,20)(H2,17,18,21) |
| InChIKey | PWZQONHLLIJOFD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |