C12H9FN4O3 — CID 107589277
2-fluoro-5-(pyrimidin-5-ylcarbamoylamino)benzoic acid (PubChem CID 107589277) has the molecular formula C12H9FN4O3 and a molecular weight of 276.23 g/mol. Its IUPAC name is 2-fluoro-5-(pyrimidin-5-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-fluoro-5-(pyrimidin-5-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107589277 |
| Molecular Formula | C12H9FN4O3 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-fluoro-5-(pyrimidin-5-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1cncnc1)Nc1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H9FN4O3/c13-10-2-1-7(3-9(10)11(18)19)16-12(20)17-8-4-14-6-15-5-8/h1-6H,(H,18,19)(H2,16,17,20) |
| InChIKey | AIUPNLYKYRNQCA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |