C13H9FN2O4 — CID 81445446
2-fluoro-5-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid (PubChem CID 81445446) has the molecular formula C13H9FN2O4 and a molecular weight of 276.22 g/mol. Its IUPAC name is 2-fluoro-5-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-fluoro-5-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 81445446 |
| Molecular Formula | C13H9FN2O4 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-fluoro-5-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccc(F)c(C(=O)O)c1)c1ccncc1O |
| InChI | InChI=1S/C13H9FN2O4/c14-10-2-1-7(5-9(10)13(19)20)16-12(18)8-3-4-15-6-11(8)17/h1-6,17H,(H,16,18)(H,19,20) |
| InChIKey | YWZIFKWRJUGPDZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |